C22H17BrI2N2O3 — CID 126147597
(2S)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 126147597) has the molecular formula C22H17BrI2N2O3 and a molecular weight of 691.10 g/mol. Its IUPAC name is (2S)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2S)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 126147597 |
| Molecular Formula | C22H17BrI2N2O3 |
| Molecular Weight | 691.10 g/mol |
| Exact Mass | 689.85 |
| IUPAC Name | (2S)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(N/N=C\c1cc(I)c(OCc2ccc(Br)cc2)c(I)c1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H17BrI2N2O3/c23-17-8-6-14(7-9-17)13-30-21-18(24)10-15(11-19(21)25)12-26-27-22(29)20(28)16-4-2-1-3-5-16/h1-12,20,28H,13H2,(H,27,29)/b26-12-/t20-/m0/s1 |
| InChIKey | NBQLXZRWCJUMBV-ZEJFDVOKSA-N |
| XLogP | 5.42 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.10 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|