C24H23IN2O4 — CID 126155865
(2R)-N-[(Z)-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 126155865) has the molecular formula C24H23IN2O4 and a molecular weight of 530.36 g/mol. Its IUPAC name is (2R)-N-[(Z)-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2R)-N-[(Z)-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 126155865 |
| Molecular Formula | C24H23IN2O4 |
| Molecular Weight | 530.36 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | (2R)-N-[(Z)-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](O)c2ccccc2)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H23IN2O4/c1-2-30-21-14-18(13-20(25)23(21)31-16-17-9-5-3-6-10-17)15-26-27-24(29)22(28)19-11-7-4-8-12-19/h3-15,22,28H,2,16H2,1H3,(H,27,29)/b26-15-/t22-/m1/s1 |
| InChIKey | KOUUVSIIXBVJLG-XLBQOGMNSA-N |
| XLogP | 4.45 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|