C23H20BrIN2O4 — CID 126151980
5-bromo-N-[(Z)-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]-2-hydroxybenzamide (PubChem CID 126151980) has the molecular formula C23H20BrIN2O4 and a molecular weight of 595.23 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-[(Z)-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 126151980 |
| Molecular Formula | C23H20BrIN2O4 |
| Molecular Weight | 595.23 g/mol |
| Exact Mass | 593.97 |
| IUPAC Name | 5-bromo-N-[(Z)-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]-2-hydroxybenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc(Br)ccc2O)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H20BrIN2O4/c1-2-30-21-11-16(10-19(25)22(21)31-14-15-6-4-3-5-7-15)13-26-27-23(29)18-12-17(24)8-9-20(18)28/h3-13,28H,2,14H2,1H3,(H,27,29)/b26-13- |
| InChIKey | PCNRYHAZZOXLAH-ZMFRSBBQSA-N |
| XLogP | 5.50 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.23 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|