C22H18BrClIN3O3 — CID 3280407
N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-chloropyridine-3-carboxamide (PubChem CID 3280407) has the molecular formula C22H18BrClIN3O3 and a molecular weight of 614.67 g/mol. Its IUPAC name is N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-chloropyridine-3-carboxamide.
| Compound Name | N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 3280407 |
| Molecular Formula | C22H18BrClIN3O3 |
| Molecular Weight | 614.67 g/mol |
| Exact Mass | 612.93 |
| IUPAC Name | N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-chloropyridine-3-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)c2cccnc2Cl)cc(I)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H18BrClIN3O3/c1-2-30-19-11-15(12-27-28-22(29)17-4-3-9-26-21(17)24)10-18(25)20(19)31-13-14-5-7-16(23)8-6-14/h3-12H,2,13H2,1H3,(H,28,29) |
| InChIKey | LUTFJTDPNNWQHO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|