C22H17Cl3IN3O3 — CID 3992862
2-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]pyridine-3-carboxamide (PubChem CID 3992862) has the molecular formula C22H17Cl3IN3O3 and a molecular weight of 604.66 g/mol. Its IUPAC name is 2-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3992862 |
| Molecular Formula | C22H17Cl3IN3O3 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 602.94 |
| IUPAC Name | 2-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]pyridine-3-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)c2cccnc2Cl)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H17Cl3IN3O3/c1-2-31-19-9-13(11-28-29-22(30)16-4-3-7-27-21(16)25)8-18(26)20(19)32-12-14-5-6-15(23)10-17(14)24/h3-11H,2,12H2,1H3,(H,29,30) |
| InChIKey | XWTXBFQJGUJCMK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|