C25H23Cl2IN2O4 — CID 17246204
N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-4-ethoxybenzamide (PubChem CID 17246204) has the molecular formula C25H23Cl2IN2O4 and a molecular weight of 613.28 g/mol. Its IUPAC name is N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-4-ethoxybenzamide.
| Compound Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 17246204 |
| Molecular Formula | C25H23Cl2IN2O4 |
| Molecular Weight | 613.28 g/mol |
| Exact Mass | 612.01 |
| IUPAC Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(I)c(OCc3ccc(Cl)cc3Cl)c(OCC)c2)cc1 |
| InChI | InChI=1S/C25H23Cl2IN2O4/c1-3-32-20-9-6-17(7-10-20)25(31)30-29-14-16-11-22(28)24(23(12-16)33-4-2)34-15-18-5-8-19(26)13-21(18)27/h5-14H,3-4,15H2,1-2H3,(H,30,31)/b29-14+ |
| InChIKey | FZPTWOHIPXMIOU-IPPBACCNSA-N |
| XLogP | 6.74 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.28 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|