C24H21Cl2IN2O4 — CID 124537190
N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-4-ethoxybenzamide (PubChem CID 124537190) has the molecular formula C24H21Cl2IN2O4 and a molecular weight of 599.25 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-4-ethoxybenzamide.
| Compound Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 124537190 |
| Molecular Formula | C24H21Cl2IN2O4 |
| Molecular Weight | 599.25 g/mol |
| Exact Mass | 597.99 |
| IUPAC Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C\c2cc(I)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H21Cl2IN2O4/c1-3-32-19-8-5-16(6-9-19)24(30)29-28-13-15-10-21(27)23(22(11-15)31-2)33-14-17-4-7-18(25)12-20(17)26/h4-13H,3,14H2,1-2H3,(H,29,30)/b28-13- |
| InChIKey | CQSTVOIFEJRZGX-QDTIIGTASA-N |
| XLogP | 6.35 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.25 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|