C31H26Cl2N2O6 — CID 51062009
[4-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-ethoxybenzoate (PubChem CID 51062009) has the molecular formula C31H26Cl2N2O6 and a molecular weight of 593.46 g/mol. Its IUPAC name is [4-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-ethoxybenzoate.
| Compound Name | [4-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 51062009 |
| Molecular Formula | C31H26Cl2N2O6 |
| Molecular Weight | 593.46 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | [4-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(/C=N/NC(=O)c3ccc(OCc4ccc(Cl)cc4Cl)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C31H26Cl2N2O6/c1-3-39-25-13-8-22(9-14-25)31(37)41-28-15-4-20(16-29(28)38-2)18-34-35-30(36)21-6-11-26(12-7-21)40-19-23-5-10-24(32)17-27(23)33/h4-18H,3,19H2,1-2H3,(H,35,36)/b34-18+ |
| InChIKey | XPWACROVHMTREC-FABQOPTDSA-N |
| XLogP | 6.96 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.46 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|