C29H21BrCl2N2O5 — CID 51061742
[4-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate (PubChem CID 51061742) has the molecular formula C29H21BrCl2N2O5 and a molecular weight of 628.31 g/mol. Its IUPAC name is [4-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate.
| Compound Name | [4-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 51061742 |
| Molecular Formula | C29H21BrCl2N2O5 |
| Molecular Weight | 628.31 g/mol |
| Exact Mass | 626.00 |
| IUPAC Name | [4-[(E)-[[4-[(2,4-dichlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(OCc3ccc(Cl)cc3Cl)cc2)ccc1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C29H21BrCl2N2O5/c1-37-27-13-18(5-12-26(27)39-29(36)20-3-2-4-22(30)14-20)16-33-34-28(35)19-7-10-24(11-8-19)38-17-21-6-9-23(31)15-25(21)32/h2-16H,17H2,1H3,(H,34,35)/b33-16+ |
| InChIKey | DEBDWEIEENKVDF-MHDJOFBISA-N |
| XLogP | 7.33 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.31 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|