C23H20Cl2N2O4 — CID 51061983
4-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]benzamide (PubChem CID 51061983) has the molecular formula C23H20Cl2N2O4 and a molecular weight of 459.33 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 51061983 |
| Molecular Formula | C23H20Cl2N2O4 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(OC)c(/C=N/NC(=O)c2ccc(OCc3ccc(Cl)cc3Cl)cc2)c1 |
| InChI | InChI=1S/C23H20Cl2N2O4/c1-29-20-9-10-22(30-2)17(11-20)13-26-27-23(28)15-4-7-19(8-5-15)31-14-16-3-6-18(24)12-21(16)25/h3-13H,14H2,1-2H3,(H,27,28)/b26-13+ |
| InChIKey | OJJOOXHILXJOKW-LGJNPRDNSA-N |
| XLogP | 5.35 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|