C21H16Cl2N2O4 — CID 137105852
4-[(2,4-dichlorophenyl)methoxy]-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]benzamide (PubChem CID 137105852) has the molecular formula C21H16Cl2N2O4 and a molecular weight of 431.28 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methoxy]-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(2,4-dichlorophenyl)methoxy]-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137105852 |
| Molecular Formula | C21H16Cl2N2O4 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methoxy]-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(O)cc1O)c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H16Cl2N2O4/c22-16-5-1-15(19(23)9-16)12-29-18-7-3-13(4-8-18)21(28)25-24-11-14-2-6-17(26)10-20(14)27/h1-11,26-27H,12H2,(H,25,28)/b24-11- |
| InChIKey | YOHDWBRZJAFYRO-MYKKPKGFSA-N |
| XLogP | 4.75 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|