C21H15Cl2N3O4 — CID 137173612
2,4-dichloro-N-[4-[[(Z)-(2,4-dihydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 137173612) has the molecular formula C21H15Cl2N3O4 and a molecular weight of 444.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[[(Z)-(2,4-dihydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[[(Z)-(2,4-dihydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 137173612 |
| Molecular Formula | C21H15Cl2N3O4 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 2,4-dichloro-N-[4-[[(Z)-(2,4-dihydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(N/N=C\c1ccc(O)cc1O)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H15Cl2N3O4/c22-14-4-8-17(18(23)9-14)21(30)25-15-5-1-12(2-6-15)20(29)26-24-11-13-3-7-16(27)10-19(13)28/h1-11,27-28H,(H,25,30)(H,26,29)/b24-11- |
| InChIKey | RPEDQMNKDKDEKN-MYKKPKGFSA-N |
| XLogP | 4.42 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|