C22H14Cl4N4O2 — CID 6894297
1-N,4-N-bis[(E)-(2,4-dichlorophenyl)methylideneamino]benzene-1,4-dicarboxamide (PubChem CID 6894297) has the molecular formula C22H14Cl4N4O2 and a molecular weight of 508.19 g/mol. Its IUPAC name is 1-N,4-N-bis[(E)-(2,4-dichlorophenyl)methylideneamino]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(E)-(2,4-dichlorophenyl)methylideneamino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 6894297 |
| Molecular Formula | C22H14Cl4N4O2 |
| Molecular Weight | 508.19 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | 1-N,4-N-bis[(E)-(2,4-dichlorophenyl)methylideneamino]benzene-1,4-dicarboxamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1Cl)c1ccc(C(=O)N/N=C/c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H14Cl4N4O2/c23-17-7-5-15(19(25)9-17)11-27-29-21(31)13-1-2-14(4-3-13)22(32)30-28-12-16-6-8-18(24)10-20(16)26/h1-12H,(H,29,31)(H,30,32)/b27-11+,28-12+ |
| InChIKey | FCXUCKNNWFKCEE-NXMZODBASA-N |
| XLogP | 5.83 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.19 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|