C30H24Cl4N4O4 — CID 139078702
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-methoxybenzamide (PubChem CID 139078702) has the molecular formula C30H24Cl4N4O4 and a molecular weight of 646.36 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-methoxybenzamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 139078702 |
| Molecular Formula | C30H24Cl4N4O4 |
| Molecular Weight | 646.36 g/mol |
| Exact Mass | 644.06 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/N=C/c2ccc(Cl)cc2Cl)c1.COc1cccc(C(=O)N/N=C/c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/2C15H12Cl2N2O2/c2*1-21-13-4-2-3-10(7-13)15(20)19-18-9-11-5-6-12(16)8-14(11)17/h2*2-9H,1H3,(H,19,20)/b2*18-9+ |
| InChIKey | GNCOZLRXIZKYDE-LZPDKLTRSA-N |
| XLogP | 7.53 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.36 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|