C14H11Cl2N3O — CID 7334458
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6-methylpyridine-3-carboxamide (PubChem CID 7334458) has the molecular formula C14H11Cl2N3O and a molecular weight of 308.17 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 7334458 |
| Molecular Formula | C14H11Cl2N3O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N/N=C/c2ccc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C14H11Cl2N3O/c1-9-2-3-11(7-17-9)14(20)19-18-8-10-4-5-12(15)6-13(10)16/h2-8H,1H3,(H,19,20)/b18-8+ |
| InChIKey | BWJYJHWZILXDGJ-QGMBQPNBSA-N |
| XLogP | 3.46 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|