C21H14Cl3N3O2 — CID 94836336
4-[(4-chlorobenzoyl)amino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide (PubChem CID 94836336) has the molecular formula C21H14Cl3N3O2 and a molecular weight of 446.72 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 94836336 |
| Molecular Formula | C21H14Cl3N3O2 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1Cl)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H14Cl3N3O2/c22-16-6-1-13(2-7-16)20(28)26-18-9-4-14(5-10-18)21(29)27-25-12-15-3-8-17(23)11-19(15)24/h1-12H,(H,26,28)(H,27,29)/b25-12- |
| InChIKey | MZLIMMQXRGGCMY-ROTLSHHCSA-N |
| XLogP | 5.66 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|