C18H18Cl2N4O2 — CID 4256811
N-[(2,4-dichlorophenyl)methylideneamino]-4-(propylcarbamoylamino)benzamide (PubChem CID 4256811) has the molecular formula C18H18Cl2N4O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-4-(propylcarbamoylamino)benzamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-4-(propylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 4256811 |
| Molecular Formula | C18H18Cl2N4O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-4-(propylcarbamoylamino)benzamide |
| SMILES | CCCNC(=O)Nc1ccc(C(=O)NN=Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N4O2/c1-2-9-21-18(26)23-15-7-4-12(5-8-15)17(25)24-22-11-13-3-6-14(19)10-16(13)20/h3-8,10-11H,2,9H2,1H3,(H,24,25)(H2,21,23,26) |
| InChIKey | LHQKFEHDVIFCBC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|