C20H22Cl2N2O4 — CID 3460491
N-[(2,4-dichlorophenyl)methylideneamino]-3,4,5-triethoxybenzamide (PubChem CID 3460491) has the molecular formula C20H22Cl2N2O4 and a molecular weight of 425.31 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 3460491 |
| Molecular Formula | C20H22Cl2N2O4 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NN=Cc2ccc(Cl)cc2Cl)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H22Cl2N2O4/c1-4-26-17-9-14(10-18(27-5-2)19(17)28-6-3)20(25)24-23-12-13-7-8-15(21)11-16(13)22/h7-12H,4-6H2,1-3H3,(H,24,25) |
| InChIKey | PTXSGKLUWWJEIN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|