C25H23Cl2N3O3 — CID 3365256
4-tert-butyl-N-[4-[[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 3365256) has the molecular formula C25H23Cl2N3O3 and a molecular weight of 484.38 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3365256 |
| Molecular Formula | C25H23Cl2N3O3 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 4-tert-butyl-N-[4-[[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(=O)NN=Cc3cc(Cl)cc(Cl)c3O)cc2)cc1 |
| InChI | InChI=1S/C25H23Cl2N3O3/c1-25(2,3)18-8-4-15(5-9-18)23(32)29-20-10-6-16(7-11-20)24(33)30-28-14-17-12-19(26)13-21(27)22(17)31/h4-14,31H,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | QDUQKTSIWCALCA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|