C17H15Cl2CuN3O6 — CID 135510087
copper;N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]pyridine-4-carboxamide;diacetate (PubChem CID 135510087) has the molecular formula C17H15Cl2CuN3O6 and a molecular weight of 491.77 g/mol. Its IUPAC name is copper;N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]pyridine-4-carboxamide;diacetate.
| Compound Name | copper;N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]pyridine-4-carboxamide;diacetate |
|---|---|
| PubChem CID | 135510087 |
| Molecular Formula | C17H15Cl2CuN3O6 |
| Molecular Weight | 491.77 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | copper;N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]pyridine-4-carboxamide;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].O=C(N/N=C/c1cc(Cl)cc(Cl)c1O)c1ccncc1.[Cu+2] |
| InChI | InChI=1S/C13H9Cl2N3O2.2C2H4O2.Cu/c14-10-5-9(12(19)11(15)6-10)7-17-18-13(20)8-1-3-16-4-2-8;2*1-2(3)4;/h1-7,19H,(H,18,20);2*1H3,(H,3,4);/q;;;+2/p-2/b17-7+;;; |
| InChIKey | KXWDNAUDPDDXEV-SLWJBZKLSA-L |
| XLogP | 0.37 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.77 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|