C13H9N5O6 — CID 135479212
N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]pyridine-4-carboxamide (PubChem CID 135479212) has the molecular formula C13H9N5O6 and a molecular weight of 331.24 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135479212 |
| Molecular Formula | C13H9N5O6 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)c1ccncc1 |
| InChI | InChI=1S/C13H9N5O6/c19-12-9(5-10(17(21)22)6-11(12)18(23)24)7-15-16-13(20)8-1-3-14-4-2-8/h1-7,19H,(H,16,20)/b15-7+ |
| InChIKey | SVBZYSJZFUZRNH-VIZOYTHASA-N |
| XLogP | 1.37 |
| TPSA | 160.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|