C14H9ClN4O6 — CID 135579203
4-chloro-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]benzamide (PubChem CID 135579203) has the molecular formula C14H9ClN4O6 and a molecular weight of 364.70 g/mol. Its IUPAC name is 4-chloro-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135579203 |
| Molecular Formula | C14H9ClN4O6 |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 4-chloro-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H9ClN4O6/c15-10-3-1-8(2-4-10)14(21)17-16-7-9-5-11(18(22)23)6-12(13(9)20)19(24)25/h1-7,20H,(H,17,21)/b16-7+ |
| InChIKey | MOGSFGDIYRPXHH-FRKPEAEDSA-N |
| XLogP | 2.63 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|