C21H14Cl2N4O5 — CID 171135932
4-[(4-chlorobenzoyl)amino]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]benzamide (PubChem CID 171135932) has the molecular formula C21H14Cl2N4O5 and a molecular weight of 473.27 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 171135932 |
| Molecular Formula | C21H14Cl2N4O5 |
| Molecular Weight | 473.27 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cc(Cl)cc([N+](=O)[O-])c1O)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H14Cl2N4O5/c22-15-5-1-12(2-6-15)20(29)25-17-7-3-13(4-8-17)21(30)26-24-11-14-9-16(23)10-18(19(14)28)27(31)32/h1-11,28H,(H,25,29)(H,26,30) |
| InChIKey | CZSCQLKMPOACDZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|