C15H11Cl2N3O5 — CID 135578991
N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-chlorophenoxy)acetamide (PubChem CID 135578991) has the molecular formula C15H11Cl2N3O5 and a molecular weight of 384.18 g/mol. Its IUPAC name is N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-chlorophenoxy)acetamide.
| Compound Name | N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 135578991 |
| Molecular Formula | C15H11Cl2N3O5 |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-chlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)N/N=C/c1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H11Cl2N3O5/c16-10-1-3-12(4-2-10)25-8-14(21)19-18-7-9-5-11(17)6-13(15(9)22)20(23)24/h1-7,22H,8H2,(H,19,21)/b18-7+ |
| InChIKey | UGDDSLOJTSWFNB-CNHKJKLMSA-N |
| XLogP | 3.14 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|