C16H15ClN4O4S — CID 135796396
1-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(4-ethoxyphenyl)thiourea (PubChem CID 135796396) has the molecular formula C16H15ClN4O4S and a molecular weight of 394.84 g/mol. Its IUPAC name is 1-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 135796396 |
| Molecular Formula | C16H15ClN4O4S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N/N=C\c2cc(Cl)cc([N+](=O)[O-])c2O)cc1 |
| InChI | InChI=1S/C16H15ClN4O4S/c1-2-25-13-5-3-12(4-6-13)19-16(26)20-18-9-10-7-11(17)8-14(15(10)22)21(23)24/h3-9,22H,2H2,1H3,(H2,19,20,26)/b18-9- |
| InChIKey | UXXUCFJSRWWNLD-NVMNQCDNSA-N |
| XLogP | 3.67 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|