C15H12ClN5O5S — CID 135469501
1-(4-chloro-2-methylphenyl)-3-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]thiourea (PubChem CID 135469501) has the molecular formula C15H12ClN5O5S and a molecular weight of 409.81 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]thiourea.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135469501 |
| Molecular Formula | C15H12ClN5O5S |
| Molecular Weight | 409.81 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]thiourea |
| SMILES | Cc1cc(Cl)ccc1NC(=S)N/N=C/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H12ClN5O5S/c1-8-4-10(16)2-3-12(8)18-15(27)19-17-7-9-5-11(20(23)24)6-13(14(9)22)21(25)26/h2-7,22H,1H3,(H2,18,19,27)/b17-7+ |
| InChIKey | VKHXYYHYCASSEP-REZTVBANSA-N |
| XLogP | 3.49 |
| TPSA | 142.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|