C14H11N5O6 — CID 135403951
1-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-3-phenylurea (PubChem CID 135403951) has the molecular formula C14H11N5O6 and a molecular weight of 345.27 g/mol. Its IUPAC name is 1-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-3-phenylurea.
| Compound Name | 1-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 135403951 |
| Molecular Formula | C14H11N5O6 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-3-phenylurea |
| SMILES | O=C(N/N=C/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)Nc1ccccc1 |
| InChI | InChI=1S/C14H11N5O6/c20-13-9(6-11(18(22)23)7-12(13)19(24)25)8-15-17-14(21)16-10-4-2-1-3-5-10/h1-8,20H,(H2,16,17,21)/b15-8+ |
| InChIKey | VDTWMPQDRXLFCR-OVCLIPMQSA-N |
| XLogP | 2.36 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|