C23H19N5O7 — CID 136909108
N-[2-[(2Z)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide (PubChem CID 136909108) has the molecular formula C23H19N5O7 and a molecular weight of 477.43 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[(2Z)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 136909108 |
| Molecular Formula | C23H19N5O7 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-[2-[(2Z)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
| SMILES | O=C(CNC(=O)C(c1ccccc1)c1ccccc1)N/N=C\c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C23H19N5O7/c29-20(26-25-13-17-11-18(27(32)33)12-19(22(17)30)28(34)35)14-24-23(31)21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,21,30H,14H2,(H,24,31)(H,26,29)/b25-13- |
| InChIKey | APUIDVRMQNLZQO-MXAYSNPKSA-N |
| XLogP | 2.61 |
| TPSA | 177.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|