C16H15N5O6 — CID 136919359
N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-(3-methylanilino)acetamide (PubChem CID 136919359) has the molecular formula C16H15N5O6 and a molecular weight of 373.33 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-(3-methylanilino)acetamide.
| Compound Name | N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-(3-methylanilino)acetamide |
|---|---|
| PubChem CID | 136919359 |
| Molecular Formula | C16H15N5O6 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-(3-methylanilino)acetamide |
| SMILES | Cc1cccc(NCC(=O)N/N=C\c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)c1 |
| InChI | InChI=1S/C16H15N5O6/c1-10-3-2-4-12(5-10)17-9-15(22)19-18-8-11-6-13(20(24)25)7-14(16(11)23)21(26)27/h2-8,17,23H,9H2,1H3,(H,19,22)/b18-8- |
| InChIKey | OQAGLONTNJBPKB-LSCVHKIXSA-N |
| XLogP | 2.08 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|