C19H15BrN4O4 — CID 135737263
N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide (PubChem CID 135737263) has the molecular formula C19H15BrN4O4 and a molecular weight of 443.26 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide.
| Compound Name | N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide |
|---|---|
| PubChem CID | 135737263 |
| Molecular Formula | C19H15BrN4O4 |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide |
| SMILES | O=C(CNc1ccc2ccccc2c1)N/N=C\c1cc(Br)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H15BrN4O4/c20-15-7-14(19(26)17(9-15)24(27)28)10-22-23-18(25)11-21-16-6-5-12-3-1-2-4-13(12)8-16/h1-10,21,26H,11H2,(H,23,25)/b22-10- |
| InChIKey | BOASRMIIYSFYLJ-YVNNLAQVSA-N |
| XLogP | 3.78 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|