C15H11BrN4O6 — CID 136844889
N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-nitrophenyl)acetamide (PubChem CID 136844889) has the molecular formula C15H11BrN4O6 and a molecular weight of 423.18 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 136844889 |
| Molecular Formula | C15H11BrN4O6 |
| Molecular Weight | 423.18 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N/N=C\c1cc(Br)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H11BrN4O6/c16-11-6-10(15(22)13(7-11)20(25)26)8-17-18-14(21)5-9-1-3-12(4-2-9)19(23)24/h1-4,6-8,22H,5H2,(H,18,21)/b17-8- |
| InChIKey | GHZGCAMYOHTERB-IUXPMGMMSA-N |
| XLogP | 2.66 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|