C17H16BrN3O6 — CID 136800675
N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 136800675) has the molecular formula C17H16BrN3O6 and a molecular weight of 438.23 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 136800675 |
| Molecular Formula | C17H16BrN3O6 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C\c2cc(Br)cc([N+](=O)[O-])c2O)cc1OC |
| InChI | InChI=1S/C17H16BrN3O6/c1-26-14-4-3-10(5-15(14)27-2)6-16(22)20-19-9-11-7-12(18)8-13(17(11)23)21(24)25/h3-5,7-9,23H,6H2,1-2H3,(H,20,22)/b19-9- |
| InChIKey | NNDGSMXYJJFVNA-OCKHKDLRSA-N |
| XLogP | 2.77 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|