C17H16BrIN2O4 — CID 135579470
N-[(E)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 135579470) has the molecular formula C17H16BrIN2O4 and a molecular weight of 519.13 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135579470 |
| Molecular Formula | C17H16BrIN2O4 |
| Molecular Weight | 519.13 g/mol |
| Exact Mass | 517.93 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C/c2cc(Br)cc(I)c2O)cc1OC |
| InChI | InChI=1S/C17H16BrIN2O4/c1-24-14-4-3-10(5-15(14)25-2)6-16(22)21-20-9-11-7-12(18)8-13(19)17(11)23/h3-5,7-9,23H,6H2,1-2H3,(H,21,22)/b20-9+ |
| InChIKey | PVSZDYPBQXSKFQ-AWQFTUOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.13 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|