C24H22Br2N2O4 — CID 126367316
N-[(E)-(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 126367316) has the molecular formula C24H22Br2N2O4 and a molecular weight of 562.26 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126367316 |
| Molecular Formula | C24H22Br2N2O4 |
| Molecular Weight | 562.26 g/mol |
| Exact Mass | 559.99 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C/c2cc(Br)cc(Br)c2OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C24H22Br2N2O4/c1-30-21-9-8-17(10-22(21)31-2)11-23(29)28-27-14-18-12-19(25)13-20(26)24(18)32-15-16-6-4-3-5-7-16/h3-10,12-14H,11,15H2,1-2H3,(H,28,29)/b27-14+ |
| InChIKey | JKOZJMYCDBUYLF-MZJWZYIUSA-N |
| XLogP | 5.50 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.26 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|