C24H24N2O4 — CID 59185880
N-[(E)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-phenylacetamide (PubChem CID 59185880) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[(E)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(E)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 59185880 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[(E)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-phenylacetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cc2ccccc2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H24N2O4/c1-28-21-13-20(16-25-26-23(27)15-18-9-5-3-6-10-18)14-22(29-2)24(21)30-17-19-11-7-4-8-12-19/h3-14,16H,15,17H2,1-2H3,(H,26,27)/b25-16+ |
| InChIKey | WGTXYANQAXTFFJ-PCLIKHOPSA-N |
| XLogP | 3.98 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|