C23H23N3O4 — CID 110512033
2-amino-N-[(Z)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide (PubChem CID 110512033) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-amino-N-[(Z)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 2-amino-N-[(Z)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 110512033 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-amino-N-[(Z)-(3,5-dimethoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccccc2N)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H23N3O4/c1-28-20-12-17(14-25-26-23(27)18-10-6-7-11-19(18)24)13-21(29-2)22(20)30-15-16-8-4-3-5-9-16/h3-14H,15,24H2,1-2H3,(H,26,27)/b25-14- |
| InChIKey | RNWMJXPEBJIYRG-QFEZKATASA-N |
| XLogP | 3.63 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|