C22H18Br2N2O2 — CID 3927693
N-[(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-2-phenylacetamide (PubChem CID 3927693) has the molecular formula C22H18Br2N2O2 and a molecular weight of 502.21 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 3927693 |
| Molecular Formula | C22H18Br2N2O2 |
| Molecular Weight | 502.21 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | N-[(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NN=Cc1cc(Br)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H18Br2N2O2/c23-19-12-18(14-25-26-21(27)11-16-7-3-1-4-8-16)22(20(24)13-19)28-15-17-9-5-2-6-10-17/h1-10,12-14H,11,15H2,(H,26,27) |
| InChIKey | YAMWLADZXGRWKF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.21 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|