C23H24Br2N2O2 — CID 98078736
(1R,6S,7S)-N-[(Z)-(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 98078736) has the molecular formula C23H24Br2N2O2 and a molecular weight of 520.27 g/mol. Its IUPAC name is (1R,6S,7S)-N-[(Z)-(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1R,6S,7S)-N-[(Z)-(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 98078736 |
| Molecular Formula | C23H24Br2N2O2 |
| Molecular Weight | 520.27 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | (1R,6S,7S)-N-[(Z)-(3,5-dibromo-2-phenylmethoxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | C[C@@]12CCCC[C@H]1[C@@H]2C(=O)N/N=C\c1cc(Br)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H24Br2N2O2/c1-23-10-6-5-9-18(23)20(23)22(28)27-26-13-16-11-17(24)12-19(25)21(16)29-14-15-7-3-2-4-8-15/h2-4,7-8,11-13,18,20H,5-6,9-10,14H2,1H3,(H,27,28)/b26-13-/t18-,20+,23+/m0/s1 |
| InChIKey | WXTBHZADHSJOJD-YLGUBFFWSA-N |
| XLogP | 6.07 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.27 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|