C16H19BrN2O2 — CID 136856611
(1S,6R,7S)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 136856611) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is (1S,6R,7S)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6R,7S)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 136856611 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (1S,6R,7S)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | C[C@]12CCCC[C@@H]1[C@@H]2C(=O)N/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C16H19BrN2O2/c1-16-7-3-2-4-12(16)14(16)15(21)19-18-9-10-8-11(17)5-6-13(10)20/h5-6,8-9,12,14,20H,2-4,7H2,1H3,(H,19,21)/b18-9-/t12-,14-,16+/m1/s1 |
| InChIKey | MBCOXVJKGCZOHJ-NDUKABBZSA-N |
| XLogP | 3.43 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|