C16H18I2N2O2 — CID 137127310
(1S,6R,7R)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 137127310) has the molecular formula C16H18I2N2O2 and a molecular weight of 524.14 g/mol. Its IUPAC name is (1S,6R,7R)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6R,7R)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 137127310 |
| Molecular Formula | C16H18I2N2O2 |
| Molecular Weight | 524.14 g/mol |
| Exact Mass | 523.95 |
| IUPAC Name | (1S,6R,7R)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | C[C@]12CCCC[C@@H]1[C@H]2C(=O)N/N=C\c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C16H18I2N2O2/c1-16-5-3-2-4-11(16)13(16)15(22)20-19-8-9-6-10(17)7-12(18)14(9)21/h6-8,11,13,21H,2-5H2,1H3,(H,20,22)/b19-8-/t11-,13+,16+/m1/s1 |
| InChIKey | OBZMZYTYMUYFRN-RHSCBUCGSA-N |
| XLogP | 3.88 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.14 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|