C23H26N2O2 — CID 126060333
(1S,6R,7R)-1-methyl-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 126060333) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1S,6R,7R)-1-methyl-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6R,7R)-1-methyl-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 126060333 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (1S,6R,7R)-1-methyl-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | C[C@]12CCCC[C@@H]1[C@H]2C(=O)N/N=C\c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H26N2O2/c1-23-13-6-5-12-20(23)21(23)22(26)25-24-15-18-10-7-11-19(14-18)27-16-17-8-3-2-4-9-17/h2-4,7-11,14-15,20-21H,5-6,12-13,16H2,1H3,(H,25,26)/b24-15-/t20-,21+,23+/m1/s1 |
| InChIKey | DRQUAAIMRRKRNI-NFYVVFRUSA-N |
| XLogP | 4.54 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|