C18H16Br2N2O6 — CID 6300600
2-[2,4-dibromo-6-[(Z)-[[2-(2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 6300600) has the molecular formula C18H16Br2N2O6 and a molecular weight of 516.14 g/mol. Its IUPAC name is 2-[2,4-dibromo-6-[(Z)-[[2-(2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,4-dibromo-6-[(Z)-[[2-(2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6300600 |
| Molecular Formula | C18H16Br2N2O6 |
| Molecular Weight | 516.14 g/mol |
| Exact Mass | 513.94 |
| IUPAC Name | 2-[2,4-dibromo-6-[(Z)-[[2-(2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1ccccc1OCC(=O)N/N=C\c1cc(Br)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C18H16Br2N2O6/c1-26-14-4-2-3-5-15(14)27-9-16(23)22-21-8-11-6-12(19)7-13(20)18(11)28-10-17(24)25/h2-8H,9-10H2,1H3,(H,22,23)(H,24,25)/b21-8- |
| InChIKey | MECCLBSCELSPJY-WNFQYIGGSA-N |
| XLogP | 3.21 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.14 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|