C16H14Br2N2O5 — CID 136749314
2-(2,4-dibromo-6-methoxyphenoxy)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 136749314) has the molecular formula C16H14Br2N2O5 and a molecular weight of 474.11 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136749314 |
| Molecular Formula | C16H14Br2N2O5 |
| Molecular Weight | 474.11 g/mol |
| Exact Mass | 471.93 |
| IUPAC Name | 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(Br)cc(Br)c1OCC(=O)N/N=C\c1ccc(O)cc1O |
| InChI | InChI=1S/C16H14Br2N2O5/c1-24-14-5-10(17)4-12(18)16(14)25-8-15(23)20-19-7-9-2-3-11(21)6-13(9)22/h2-7,21-22H,8H2,1H3,(H,20,23)/b19-7- |
| InChIKey | DOZPACWQFBKQBG-GXHLCREISA-N |
| XLogP | 3.16 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.11 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|