C16H12Br4N2O5 — CID 135479543
N-[(E)-(2,3-dibromo-4,5-dihydroxyphenyl)methylideneamino]-2-(2,4-dibromo-6-methoxyphenoxy)acetamide (PubChem CID 135479543) has the molecular formula C16H12Br4N2O5 and a molecular weight of 631.90 g/mol. Its IUPAC name is N-[(E)-(2,3-dibromo-4,5-dihydroxyphenyl)methylideneamino]-2-(2,4-dibromo-6-methoxyphenoxy)acetamide.
| Compound Name | N-[(E)-(2,3-dibromo-4,5-dihydroxyphenyl)methylideneamino]-2-(2,4-dibromo-6-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 135479543 |
| Molecular Formula | C16H12Br4N2O5 |
| Molecular Weight | 631.90 g/mol |
| Exact Mass | 627.75 |
| IUPAC Name | N-[(E)-(2,3-dibromo-4,5-dihydroxyphenyl)methylideneamino]-2-(2,4-dibromo-6-methoxyphenoxy)acetamide |
| SMILES | COc1cc(Br)cc(Br)c1OCC(=O)N/N=C/c1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C16H12Br4N2O5/c1-26-11-4-8(17)3-9(18)16(11)27-6-12(24)22-21-5-7-2-10(23)15(25)14(20)13(7)19/h2-5,23,25H,6H2,1H3,(H,22,24)/b21-5+ |
| InChIKey | BPEHGGQFLCIELF-IGCPIRJNSA-N |
| XLogP | 4.69 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|