C20H21Br4NO5 — CID 143034312
2-(2,4-dibromo-6-methoxyphenoxy)-N-methylacetamide;3,4-dibromo-5-(2-methylprop-1-enyl)benzene-1,2-diol (PubChem CID 143034312) has the molecular formula C20H21Br4NO5 and a molecular weight of 675.01 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methoxyphenoxy)-N-methylacetamide;3,4-dibromo-5-(2-methylprop-1-enyl)benzene-1,2-diol.
| Compound Name | 2-(2,4-dibromo-6-methoxyphenoxy)-N-methylacetamide;3,4-dibromo-5-(2-methylprop-1-enyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 143034312 |
| Molecular Formula | C20H21Br4NO5 |
| Molecular Weight | 675.01 g/mol |
| Exact Mass | 670.82 |
| IUPAC Name | 2-(2,4-dibromo-6-methoxyphenoxy)-N-methylacetamide;3,4-dibromo-5-(2-methylprop-1-enyl)benzene-1,2-diol |
| SMILES | CC(C)=Cc1cc(O)c(O)c(Br)c1Br.CNC(=O)COc1c(Br)cc(Br)cc1OC |
| InChI | InChI=1S/C10H11Br2NO3.C10H10Br2O2/c1-13-9(14)5-16-10-7(12)3-6(11)4-8(10)15-2;1-5(2)3-6-4-7(13)10(14)9(12)8(6)11/h3-4H,5H2,1-2H3,(H,13,14);3-4,13-14H,1-2H3 |
| InChIKey | FIPUTEUXDOHPBS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.01 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|