C16H13Br2IN2O3 — CID 4027319
2-(2,4-dibromo-6-methoxyphenoxy)-N-[(3-iodophenyl)methylideneamino]acetamide (PubChem CID 4027319) has the molecular formula C16H13Br2IN2O3 and a molecular weight of 568.00 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(3-iodophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(3-iodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4027319 |
| Molecular Formula | C16H13Br2IN2O3 |
| Molecular Weight | 568.00 g/mol |
| Exact Mass | 565.83 |
| IUPAC Name | 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(3-iodophenyl)methylideneamino]acetamide |
| SMILES | COc1cc(Br)cc(Br)c1OCC(=O)NN=Cc1cccc(I)c1 |
| InChI | InChI=1S/C16H13Br2IN2O3/c1-23-14-7-11(17)6-13(18)16(14)24-9-15(22)21-20-8-10-3-2-4-12(19)5-10/h2-8H,9H2,1H3,(H,21,22) |
| InChIKey | DOCQEWMMKHQRDW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|