C23H17Br3N2O5 — CID 3958661
[4-[[[2-(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 3958661) has the molecular formula C23H17Br3N2O5 and a molecular weight of 641.11 g/mol. Its IUPAC name is [4-[[[2-(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[[[2-(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 3958661 |
| Molecular Formula | C23H17Br3N2O5 |
| Molecular Weight | 641.11 g/mol |
| Exact Mass | 637.87 |
| IUPAC Name | [4-[[[2-(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | COc1cc(Br)cc(Br)c1OCC(=O)NN=Cc1ccc(OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H17Br3N2O5/c1-31-20-11-17(25)10-19(26)22(20)32-13-21(29)28-27-12-14-2-8-18(9-3-14)33-23(30)15-4-6-16(24)7-5-15/h2-12H,13H2,1H3,(H,28,29) |
| InChIKey | SRISPRAVOYUJGA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.11 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|