C22H16Br2N2O4 — CID 5050842
[4-[[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 5050842) has the molecular formula C22H16Br2N2O4 and a molecular weight of 532.19 g/mol. Its IUPAC name is [4-[[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 5050842 |
| Molecular Formula | C22H16Br2N2O4 |
| Molecular Weight | 532.19 g/mol |
| Exact Mass | 529.95 |
| IUPAC Name | [4-[[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | O=C(COc1ccc(Br)cc1)NN=Cc1ccc(OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H16Br2N2O4/c23-17-5-3-16(4-6-17)22(28)30-20-9-1-15(2-10-20)13-25-26-21(27)14-29-19-11-7-18(24)8-12-19/h1-13H,14H2,(H,26,27) |
| InChIKey | CPAZVADOLYZJEC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.19 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|