C19H19BrN2O3 — CID 171132245
[4-[(pentanoylhydrazinylidene)methyl]phenyl] 4-bromobenzoate (PubChem CID 171132245) has the molecular formula C19H19BrN2O3 and a molecular weight of 403.28 g/mol. Its IUPAC name is [4-[(pentanoylhydrazinylidene)methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(pentanoylhydrazinylidene)methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 171132245 |
| Molecular Formula | C19H19BrN2O3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | [4-[(pentanoylhydrazinylidene)methyl]phenyl] 4-bromobenzoate |
| SMILES | CCCCC(=O)NN=Cc1ccc(OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H19BrN2O3/c1-2-3-4-18(23)22-21-13-14-5-11-17(12-6-14)25-19(24)15-7-9-16(20)10-8-15/h5-13H,2-4H2,1H3,(H,22,23) |
| InChIKey | LECYFGWJKFRQOU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|