C34H30N4O6 — CID 4631127
[4-[[[6-[2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 4631127) has the molecular formula C34H30N4O6 and a molecular weight of 590.64 g/mol. Its IUPAC name is [4-[[[6-[2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[[[6-[2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 4631127 |
| Molecular Formula | C34H30N4O6 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | [4-[[[6-[2-[(4-benzoyloxyphenyl)methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(CCCCC(=O)NN=Cc1ccc(OC(=O)c2ccccc2)cc1)NN=Cc1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H30N4O6/c39-31(37-35-23-25-15-19-29(20-16-25)43-33(41)27-9-3-1-4-10-27)13-7-8-14-32(40)38-36-24-26-17-21-30(22-18-26)44-34(42)28-11-5-2-6-12-28/h1-6,9-12,15-24H,7-8,13-14H2,(H,37,39)(H,38,40) |
| InChIKey | BMKCVOPIVDWKAN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|